C24H25F2N3O3S — CID 167342977
N-[(5R,6S)-5-[[3-(3,5-difluorophenyl)phenyl]methyl]-2,3-dimethyl-4-oxo-5,6,7,8-tetrahydroquinazolin-6-yl]methanesulfonamide (PubChem CID 167342977) has the molecular formula C24H25F2N3O3S and a molecular weight of 473.55 g/mol. Its IUPAC name is N-[(5R,6S)-5-[[3-(3,5-difluorophenyl)phenyl]methyl]-2,3-dimethyl-4-oxo-5,6,7,8-tetrahydroquinazolin-6-yl]methanesulfonamide.
| Compound Name | N-[(5R,6S)-5-[[3-(3,5-difluorophenyl)phenyl]methyl]-2,3-dimethyl-4-oxo-5,6,7,8-tetrahydroquinazolin-6-yl]methanesulfonamide |
|---|---|
| PubChem CID | 167342977 |
| Molecular Formula | C24H25F2N3O3S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | N-[(5R,6S)-5-[[3-(3,5-difluorophenyl)phenyl]methyl]-2,3-dimethyl-4-oxo-5,6,7,8-tetrahydroquinazolin-6-yl]methanesulfonamide |
| SMILES | Cc1nc2c(c(=O)n1C)[C@@H](Cc1cccc(-c3cc(F)cc(F)c3)c1)[C@@H](NS(C)(=O)=O)CC2 |
| InChI | InChI=1S/C24H25F2N3O3S/c1-14-27-22-8-7-21(28-33(3,31)32)20(23(22)24(30)29(14)2)10-15-5-4-6-16(9-15)17-11-18(25)13-19(26)12-17/h4-6,9,11-13,20-21,28H,7-8,10H2,1-3H3/t20-,21-/m0/s1 |
| InChIKey | ILRQUDNNPXUDOG-SFTDATJTSA-N |
| XLogP | 3.22 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |