C23H23F2N3O3S — CID 162346017
N-[(3S,4S)-4-[[6-(3,5-difluorophenyl)-2-pyridinyl]methyl]-7-methyl-6-oxo-1,2,3,4-tetrahydroquinolizin-3-yl]methanesulfonamide (PubChem CID 162346017) has the molecular formula C23H23F2N3O3S and a molecular weight of 459.52 g/mol. Its IUPAC name is N-[(3S,4S)-4-[[6-(3,5-difluorophenyl)-2-pyridinyl]methyl]-7-methyl-6-oxo-1,2,3,4-tetrahydroquinolizin-3-yl]methanesulfonamide.
| Compound Name | N-[(3S,4S)-4-[[6-(3,5-difluorophenyl)-2-pyridinyl]methyl]-7-methyl-6-oxo-1,2,3,4-tetrahydroquinolizin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 162346017 |
| Molecular Formula | C23H23F2N3O3S |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | N-[(3S,4S)-4-[[6-(3,5-difluorophenyl)-2-pyridinyl]methyl]-7-methyl-6-oxo-1,2,3,4-tetrahydroquinolizin-3-yl]methanesulfonamide |
| SMILES | Cc1ccc2n(c1=O)[C@@H](Cc1cccc(-c3cc(F)cc(F)c3)n1)[C@@H](NS(C)(=O)=O)CC2 |
| InChI | InChI=1S/C23H23F2N3O3S/c1-14-6-7-19-8-9-21(27-32(2,30)31)22(28(19)23(14)29)13-18-4-3-5-20(26-18)15-10-16(24)12-17(25)11-15/h3-7,10-12,21-22,27H,8-9,13H2,1-2H3/t21-,22-/m0/s1 |
| InChIKey | GMCHSOXRVNROOO-VXKWHMMOSA-N |
| XLogP | 3.14 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |