C23H25N3O3S — CID 162346106
N-[(6S,7S)-3-methyl-4-oxo-6-[(3-phenylphenyl)methyl]-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-7-yl]methanesulfonamide (PubChem CID 162346106) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is N-[(6S,7S)-3-methyl-4-oxo-6-[(3-phenylphenyl)methyl]-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-7-yl]methanesulfonamide.
| Compound Name | N-[(6S,7S)-3-methyl-4-oxo-6-[(3-phenylphenyl)methyl]-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-7-yl]methanesulfonamide |
|---|---|
| PubChem CID | 162346106 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | N-[(6S,7S)-3-methyl-4-oxo-6-[(3-phenylphenyl)methyl]-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-7-yl]methanesulfonamide |
| SMILES | Cc1cnc2n(c1=O)[C@@H](Cc1cccc(-c3ccccc3)c1)[C@@H](NS(C)(=O)=O)CC2 |
| InChI | InChI=1S/C23H25N3O3S/c1-16-15-24-22-12-11-20(25-30(2,28)29)21(26(22)23(16)27)14-17-7-6-10-19(13-17)18-8-4-3-5-9-18/h3-10,13,15,20-21,25H,11-12,14H2,1-2H3/t20-,21-/m0/s1 |
| InChIKey | OFKITCSQYQWHLF-SFTDATJTSA-N |
| XLogP | 2.87 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |