C22H21Cl2N3OS — CID 166798450
1,3-dichloro-7-(methylsulfanylamino)-6-[(3-phenylphenyl)methyl]-6,7,8,9-tetrahydropyrido[1,2-a]pyrazin-4-one (PubChem CID 166798450) has the molecular formula C22H21Cl2N3OS and a molecular weight of 446.40 g/mol. Its IUPAC name is 1,3-dichloro-7-(methylsulfanylamino)-6-[(3-phenylphenyl)methyl]-6,7,8,9-tetrahydropyrido[1,2-a]pyrazin-4-one.
| Compound Name | 1,3-dichloro-7-(methylsulfanylamino)-6-[(3-phenylphenyl)methyl]-6,7,8,9-tetrahydropyrido[1,2-a]pyrazin-4-one |
|---|---|
| PubChem CID | 166798450 |
| Molecular Formula | C22H21Cl2N3OS |
| Molecular Weight | 446.40 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | 1,3-dichloro-7-(methylsulfanylamino)-6-[(3-phenylphenyl)methyl]-6,7,8,9-tetrahydropyrido[1,2-a]pyrazin-4-one |
| SMILES | CSNC1CCc2c(Cl)nc(Cl)c(=O)n2C1Cc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C22H21Cl2N3OS/c1-29-26-17-10-11-18-20(23)25-21(24)22(28)27(18)19(17)13-14-6-5-9-16(12-14)15-7-3-2-4-8-15/h2-9,12,17,19,26H,10-11,13H2,1H3 |
| InChIKey | OGQXDGGDSAVUHX-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.40 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|