C12H25NO — CID 167343881
4-amino-4-ethyl-2,2,6-trimethylheptan-3-one (PubChem CID 167343881) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is 4-amino-4-ethyl-2,2,6-trimethylheptan-3-one.
| Compound Name | 4-amino-4-ethyl-2,2,6-trimethylheptan-3-one |
|---|---|
| PubChem CID | 167343881 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 4-amino-4-ethyl-2,2,6-trimethylheptan-3-one |
| SMILES | CCC(N)(CC(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C12H25NO/c1-7-12(13,8-9(2)3)10(14)11(4,5)6/h9H,7-8,13H2,1-6H3 |
| InChIKey | BETWLFFICZWCGU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |