C17H15ClN2O5S2 — CID 167344340
5-(4-chlorophenyl)sulfonyl-2-(3-methoxyphenyl)-4-methylsulfonyl-1H-imidazole (PubChem CID 167344340) has the molecular formula C17H15ClN2O5S2 and a molecular weight of 426.90 g/mol. Its IUPAC name is 5-(4-chlorophenyl)sulfonyl-2-(3-methoxyphenyl)-4-methylsulfonyl-1H-imidazole.
| Compound Name | 5-(4-chlorophenyl)sulfonyl-2-(3-methoxyphenyl)-4-methylsulfonyl-1H-imidazole |
|---|---|
| PubChem CID | 167344340 |
| Molecular Formula | C17H15ClN2O5S2 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.01 |
| IUPAC Name | 5-(4-chlorophenyl)sulfonyl-2-(3-methoxyphenyl)-4-methylsulfonyl-1H-imidazole |
| SMILES | COc1cccc(-c2nc(S(C)(=O)=O)c(S(=O)(=O)c3ccc(Cl)cc3)[nH]2)c1 |
| InChI | InChI=1S/C17H15ClN2O5S2/c1-25-13-5-3-4-11(10-13)15-19-16(26(2,21)22)17(20-15)27(23,24)14-8-6-12(18)7-9-14/h3-10H,1-2H3,(H,19,20) |
| InChIKey | DGWVBPOFLQSBPB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |