C14H22O2S2 — CID 167344924
trans-S-[(1S,3S)-3-acetylcyclopentyl] (1S,3S)-3-methylsulfanylcyclopentane-1-carbothioate (PubChem CID 167344924) has the molecular formula C14H22O2S2 and a molecular weight of 286.46 g/mol. Its IUPAC name is trans-S-[(1S,3S)-3-acetylcyclopentyl] (1S,3S)-3-methylsulfanylcyclopentane-1-carbothioate.
| Compound Name | trans-S-[(1S,3S)-3-acetylcyclopentyl] (1S,3S)-3-methylsulfanylcyclopentane-1-carbothioate |
|---|---|
| PubChem CID | 167344924 |
| Molecular Formula | C14H22O2S2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | trans-S-[(1S,3S)-3-acetylcyclopentyl] (1S,3S)-3-methylsulfanylcyclopentane-1-carbothioate |
| SMILES | CS[C@H]1CC[C@H](C(=O)S[C@H]2CC[C@H](C(C)=O)C2)C1 |
| InChI | InChI=1S/C14H22O2S2/c1-9(15)10-3-6-13(7-10)18-14(16)11-4-5-12(8-11)17-2/h10-13H,3-8H2,1-2H3/t10-,11-,12-,13-/m0/s1 |
| InChIKey | DMJHCEXCCANSSI-CYDGBPFRSA-N |
| XLogP | 3.54 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|