C13H19O2S3- — CID 167344932
cis-(1S,3R)-3-[(1S,3R)-3-methylsulfanylcarbonylcyclopentyl]sulfanylcarbonylcyclopentane-1-thiolate (PubChem CID 167344932) has the molecular formula C13H19O2S3- and a molecular weight of 303.49 g/mol. Its IUPAC name is cis-(1S,3R)-3-[(1S,3R)-3-methylsulfanylcarbonylcyclopentyl]sulfanylcarbonylcyclopentane-1-thiolate.
| Compound Name | cis-(1S,3R)-3-[(1S,3R)-3-methylsulfanylcarbonylcyclopentyl]sulfanylcarbonylcyclopentane-1-thiolate |
|---|---|
| PubChem CID | 167344932 |
| Molecular Formula | C13H19O2S3- |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | cis-(1S,3R)-3-[(1S,3R)-3-methylsulfanylcarbonylcyclopentyl]sulfanylcarbonylcyclopentane-1-thiolate |
| SMILES | CSC(=O)[C@@H]1CC[C@H](SC(=O)[C@@H]2CC[C@H]([S-])C2)C1 |
| InChI | InChI=1S/C13H20O2S3/c1-17-12(14)9-3-5-11(7-9)18-13(15)8-2-4-10(16)6-8/h8-11,16H,2-7H2,1H3/p-1/t8-,9-,10+,11+/m1/s1 |
| InChIKey | DAJVHMNCQQDGQX-ZNSHCXBVSA-M |
| XLogP | 3.02 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|