C25H24O2S — CID 21310557
cis-(1R,3S)-3-tritylsulfanylcyclopentane-1-carboxylic acid (PubChem CID 21310557) has the molecular formula C25H24O2S and a molecular weight of 388.53 g/mol. Its IUPAC name is cis-(1R,3S)-3-tritylsulfanylcyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-3-tritylsulfanylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 21310557 |
| Molecular Formula | C25H24O2S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | cis-(1R,3S)-3-tritylsulfanylcyclopentane-1-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CC[C@H](SC(c2ccccc2)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C25H24O2S/c26-24(27)19-16-17-23(18-19)28-25(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-15,19,23H,16-18H2,(H,26,27)/t19-,23+/m1/s1 |
| InChIKey | AIAOPNAMCKEYCP-XXBNENTESA-N |
| XLogP | 5.97 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|