About cis-(1S,3R)-3-tritylsulfanylcyclopentane-1-carboxylic acid
cis-(1S,3R)-3-tritylsulfanylcyclopentane-1-carboxylic acid (PubChem CID 67632062) has the molecular formula C25H24O2S
and a molecular weight of 388.53 g/mol. Its IUPAC name is cis-(1S,3R)-3-tritylsulfanylcyclopentane-1-carboxylic acid.
Molecular Properties
| Compound Name | cis-(1S,3R)-3-tritylsulfanylcyclopentane-1-carboxylic acid |
| PubChem CID | 67632062 |
| Molecular Formula | C25H24O2S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | cis-(1S,3R)-3-tritylsulfanylcyclopentane-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CC[C@@H](SC(c2ccccc2)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C25H24O2S/c26-24(27)19-16-17-23(18-19)28-25(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-15,19,23H,16-18H2,(H,26,27)/t19-,23+/m0/s1 |
| InChIKey | AIAOPNAMCKEYCP-WMZHIEFXSA-N |
| XLogP | 5.97 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze cis-(1S,3R)-3-tritylsulfanylcyclopentane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,3R)-3-tritylsulfanylcyclopentane-1-carboxylic acid?
The IUPAC name of cis-(1S,3R)-3-tritylsulfanylcyclopentane-1-carboxylic acid (CID 67632062) is cis-(1S,3R)-3-tritylsulfanylcyclopentane-1-carboxylic acid.
What is the SMILES notation for cis-(1S,3R)-3-tritylsulfanylcyclopentane-1-carboxylic acid?
The canonical SMILES for cis-(1S,3R)-3-tritylsulfanylcyclopentane-1-carboxylic acid is O=C(O)[C@H]1CC[C@@H](SC(c2ccccc2)(c2ccccc2)c2ccccc2)C1.
What is the InChIKey of cis-(1S,3R)-3-tritylsulfanylcyclopentane-1-carboxylic acid?
The InChIKey is AIAOPNAMCKEYCP-WMZHIEFXSA-N. The full InChI is InChI=1S/C25H24O2S/c26-24(27)19-16-17-23(18-19)28-25(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-15,19,23H,16-18H2,(H,26,27)/t19-,23+/m0/s1.
What are the key properties of cis-(1S,3R)-3-tritylsulfanylcyclopentane-1-carboxylic acid?
cis-(1S,3R)-3-tritylsulfanylcyclopentane-1-carboxylic acid has a molecular weight of 388.53 g/mol, XLogP of 5.97, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,3R)-3-tritylsulfanylcyclopentane-1-carboxylic acid is sourced from PubChem (CID 67632062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).