C52H57N4OPt-3 — CID 167345866
9-(4-tert-butyl-2-pyridinyl)-2-[3-[3-(2,6-dicyclohexylcyclohexyl)-2H-benzimidazol-2-id-1-yl]benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum (PubChem CID 167345866) has the molecular formula C52H57N4OPt-3 and a molecular weight of 949.13 g/mol. Its IUPAC name is 9-(4-tert-butyl-2-pyridinyl)-2-[3-[3-(2,6-dicyclohexylcyclohexyl)-2H-benzimidazol-2-id-1-yl]benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum.
| Compound Name | 9-(4-tert-butyl-2-pyridinyl)-2-[3-[3-(2,6-dicyclohexylcyclohexyl)-2H-benzimidazol-2-id-1-yl]benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum |
|---|---|
| PubChem CID | 167345866 |
| Molecular Formula | C52H57N4OPt-3 |
| Molecular Weight | 949.13 g/mol |
| Exact Mass | 948.42 |
| IUPAC Name | 9-(4-tert-butyl-2-pyridinyl)-2-[3-[3-(2,6-dicyclohexylcyclohexyl)-2H-benzimidazol-2-id-1-yl]benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c(N5[CH-]N(C6C(C7CCCCC7)CCCC6C6CCCCC6)c6ccccc65)ccc4)ccc3c3ccccc32)c1.[Pt] |
| InChI | InChI=1S/C52H57N4O.Pt/c1-52(2,3)38-30-31-53-50(32-38)56-46-25-11-10-22-44(46)45-29-28-41(34-49(45)56)57-40-21-14-20-39(33-40)54-35-55(48-27-13-12-26-47(48)54)51-42(36-16-6-4-7-17-36)23-15-24-43(51)37-18-8-5-9-19-37;/h10-14,20-22,25-32,35-37,42-43,51H,4-9,15-19,23-24H2,1-3H3;/q-3; |
| InChIKey | GYWZGONHPHKWIG-UHFFFAOYSA-N |
| XLogP | 13.89 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.13 |
| LogP ≤ 5 | 13.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|