C30H38N2O6 — CID 167346789
tert-butyl (2S)-2-[[(2S)-3-(4-but-3-enoxyphenyl)-1-oxo-1-phenylmethoxypropan-2-yl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 167346789) has the molecular formula C30H38N2O6 and a molecular weight of 522.64 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(2S)-3-(4-but-3-enoxyphenyl)-1-oxo-1-phenylmethoxypropan-2-yl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[(2S)-3-(4-but-3-enoxyphenyl)-1-oxo-1-phenylmethoxypropan-2-yl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 167346789 |
| Molecular Formula | C30H38N2O6 |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | tert-butyl (2S)-2-[[(2S)-3-(4-but-3-enoxyphenyl)-1-oxo-1-phenylmethoxypropan-2-yl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | C=CCCOc1ccc(C[C@H](NC(=O)[C@@H]2CCCN2C(=O)OC(C)(C)C)C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H38N2O6/c1-5-6-19-36-24-16-14-22(15-17-24)20-25(28(34)37-21-23-11-8-7-9-12-23)31-27(33)26-13-10-18-32(26)29(35)38-30(2,3)4/h5,7-9,11-12,14-17,25-26H,1,6,10,13,18-21H2,2-4H3,(H,31,33)/t25-,26-/m0/s1 |
| InChIKey | CXAFXYFNTIKURZ-UIOOFZCWSA-N |
| XLogP | 4.81 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|