C25H24F3NO5 — CID 16734685
2-[5-cyclopropyl-2-methyl-4-[3-[4-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]propoxy]phenoxy]acetic acid (PubChem CID 16734685) has the molecular formula C25H24F3NO5 and a molecular weight of 475.46 g/mol. Its IUPAC name is 2-[5-cyclopropyl-2-methyl-4-[3-[4-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]propoxy]phenoxy]acetic acid.
| Compound Name | 2-[5-cyclopropyl-2-methyl-4-[3-[4-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]propoxy]phenoxy]acetic acid |
|---|---|
| PubChem CID | 16734685 |
| Molecular Formula | C25H24F3NO5 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | 2-[5-cyclopropyl-2-methyl-4-[3-[4-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]propoxy]phenoxy]acetic acid |
| SMILES | Cc1cc(OCCCc2nc(-c3ccc(C(F)(F)F)cc3)co2)c(C2CC2)cc1OCC(=O)O |
| InChI | InChI=1S/C25H24F3NO5/c1-15-11-22(19(16-4-5-16)12-21(15)33-14-24(30)31)32-10-2-3-23-29-20(13-34-23)17-6-8-18(9-7-17)25(26,27)28/h6-9,11-13,16H,2-5,10,14H2,1H3,(H,30,31) |
| InChIKey | AEHQOZGVMKJLMU-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|