C25H35N5O2S — CID 167348310
1-[amino-[3-[[2-(dimethylamino)ethyl-methylamino]methyl]phenyl]-oxo-λ6-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea (PubChem CID 167348310) has the molecular formula C25H35N5O2S and a molecular weight of 469.66 g/mol. Its IUPAC name is 1-[amino-[3-[[2-(dimethylamino)ethyl-methylamino]methyl]phenyl]-oxo-λ6-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea.
| Compound Name | 1-[amino-[3-[[2-(dimethylamino)ethyl-methylamino]methyl]phenyl]-oxo-λ6-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
|---|---|
| PubChem CID | 167348310 |
| Molecular Formula | C25H35N5O2S |
| Molecular Weight | 469.66 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | 1-[amino-[3-[[2-(dimethylamino)ethyl-methylamino]methyl]phenyl]-oxo-λ6-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
| SMILES | CN(C)CCN(C)Cc1cccc(S(N)(=O)=NC(=O)Nc2c3c(cc4c2CCC4)CCC3)c1 |
| InChI | InChI=1S/C25H35N5O2S/c1-29(2)13-14-30(3)17-18-7-4-10-21(15-18)33(26,32)28-25(31)27-24-22-11-5-8-19(22)16-20-9-6-12-23(20)24/h4,7,10,15-16H,5-6,8-9,11-14,17H2,1-3H3,(H3,26,27,28,31,32) |
| InChIKey | RPKWRAWQXJKNDR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 91.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.66 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |