C21H33NO3 — CID 167349850
(3R,5R,8R,9R,10S,13S,14S)-3,17-dihydroxy-3-(methoxymethyl)-13-methyl-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17-carbonitrile (PubChem CID 167349850) has the molecular formula C21H33NO3 and a molecular weight of 347.50 g/mol. Its IUPAC name is (3R,5R,8R,9R,10S,13S,14S)-3,17-dihydroxy-3-(methoxymethyl)-13-methyl-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17-carbonitrile.
| Compound Name | (3R,5R,8R,9R,10S,13S,14S)-3,17-dihydroxy-3-(methoxymethyl)-13-methyl-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17-carbonitrile |
|---|---|
| PubChem CID | 167349850 |
| Molecular Formula | C21H33NO3 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.25 |
| IUPAC Name | (3R,5R,8R,9R,10S,13S,14S)-3,17-dihydroxy-3-(methoxymethyl)-13-methyl-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17-carbonitrile |
| SMILES | COC[C@@]1(O)CC[C@H]2[C@H](CC[C@@H]3[C@@H]2CC[C@@]2(C)[C@H]3CCC2(O)C#N)C1 |
| InChI | InChI=1S/C21H33NO3/c1-19-8-5-16-15-6-9-20(23,13-25-2)11-14(15)3-4-17(16)18(19)7-10-21(19,24)12-22/h14-18,23-24H,3-11,13H2,1-2H3/t14-,15+,16-,17-,18+,19+,20-,21?/m1/s1 |
| InChIKey | WYUZAIWSELXKOF-XUOSRMCRSA-N |
| XLogP | 3.27 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|