C12H16BrN3O3 — CID 167350868
1-[3-(5-bromo-3-methylpyrazin-2-yl)oxypyrrolidin-1-yl]-2-methoxyethanone (PubChem CID 167350868) has the molecular formula C12H16BrN3O3 and a molecular weight of 330.18 g/mol. Its IUPAC name is 1-[3-(5-bromo-3-methylpyrazin-2-yl)oxypyrrolidin-1-yl]-2-methoxyethanone.
| Compound Name | 1-[3-(5-bromo-3-methylpyrazin-2-yl)oxypyrrolidin-1-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 167350868 |
| Molecular Formula | C12H16BrN3O3 |
| Molecular Weight | 330.18 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 1-[3-(5-bromo-3-methylpyrazin-2-yl)oxypyrrolidin-1-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CCC(Oc2ncc(Br)nc2C)C1 |
| InChI | InChI=1S/C12H16BrN3O3/c1-8-12(14-5-10(13)15-8)19-9-3-4-16(6-9)11(17)7-18-2/h5,9H,3-4,6-7H2,1-2H3 |
| InChIKey | SRHKMLPLRHEHKT-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.18 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |