C17H24N2O4 — CID 167352446
2-[(E)-[3-[[4-[2-(deuterioamino)-2-oxoethyl]phenyl]methyl]-3-methylpentan-2-ylidene]amino]oxyacetic acid (PubChem CID 167352446) has the molecular formula C17H24N2O4 and a molecular weight of 321.40 g/mol. Its IUPAC name is 2-[(E)-[3-[[4-[2-(deuterioamino)-2-oxoethyl]phenyl]methyl]-3-methylpentan-2-ylidene]amino]oxyacetic acid.
| Compound Name | 2-[(E)-[3-[[4-[2-(deuterioamino)-2-oxoethyl]phenyl]methyl]-3-methylpentan-2-ylidene]amino]oxyacetic acid |
|---|---|
| PubChem CID | 167352446 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 2-[(E)-[3-[[4-[2-(deuterioamino)-2-oxoethyl]phenyl]methyl]-3-methylpentan-2-ylidene]amino]oxyacetic acid |
| SMILES | [2H]NC(=O)Cc1ccc(CC(C)(CC)/C(C)=N/OCC(=O)O)cc1 |
| InChI | InChI=1S/C17H24N2O4/c1-4-17(3,12(2)19-23-11-16(21)22)10-14-7-5-13(6-8-14)9-15(18)20/h5-8H,4,9-11H2,1-3H3,(H2,18,20)(H,21,22)/b19-12+/i/hD |
| InChIKey | WNIHFWUTQKABRB-DPTRIYJLSA-N |
| XLogP | 2.15 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|