C14H19NO3 — CID 167352354
2-[[4-[2-(deuterioamino)-2-oxoethyl]phenyl]methyl]-2-methylbutanoic acid (PubChem CID 167352354) has the molecular formula C14H19NO3 and a molecular weight of 250.32 g/mol. Its IUPAC name is 2-[[4-[2-(deuterioamino)-2-oxoethyl]phenyl]methyl]-2-methylbutanoic acid.
| Compound Name | 2-[[4-[2-(deuterioamino)-2-oxoethyl]phenyl]methyl]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 167352354 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 2-[[4-[2-(deuterioamino)-2-oxoethyl]phenyl]methyl]-2-methylbutanoic acid |
| SMILES | [2H]NC(=O)Cc1ccc(CC(C)(CC)C(=O)O)cc1 |
| InChI | InChI=1S/C14H19NO3/c1-3-14(2,13(17)18)9-11-6-4-10(5-7-11)8-12(15)16/h4-7H,3,8-9H2,1-2H3,(H2,15,16)(H,17,18)/i/hD |
| InChIKey | JWUHQAJVIJANDR-DYCDLGHISA-N |
| XLogP | 1.76 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |