About prop-2-ynoyl 2-amino-4-methoxy-5-phenylmethoxybenzoate
prop-2-ynoyl 2-amino-4-methoxy-5-phenylmethoxybenzoate (PubChem CID 167352804) has the molecular formula C18H15NO5
and a molecular weight of 325.32 g/mol. Its IUPAC name is prop-2-ynoyl 2-amino-4-methoxy-5-phenylmethoxybenzoate.
Molecular Properties
| Compound Name | prop-2-ynoyl 2-amino-4-methoxy-5-phenylmethoxybenzoate |
| PubChem CID | 167352804 |
| Molecular Formula | C18H15NO5 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | prop-2-ynoyl 2-amino-4-methoxy-5-phenylmethoxybenzoate |
| SMILES | C#CC(=O)OC(=O)c1cc(OCc2ccccc2)c(OC)cc1N |
| InChI | InChI=1S/C18H15NO5/c1-3-17(20)24-18(21)13-9-16(15(22-2)10-14(13)19)23-11-12-7-5-4-6-8-12/h1,4-10H,11,19H2,2H3 |
| InChIKey | NMSVCLIREWAPLZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze prop-2-ynoyl 2-amino-4-methoxy-5-phenylmethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-ynoyl 2-amino-4-methoxy-5-phenylmethoxybenzoate?
The IUPAC name of prop-2-ynoyl 2-amino-4-methoxy-5-phenylmethoxybenzoate (CID 167352804) is prop-2-ynoyl 2-amino-4-methoxy-5-phenylmethoxybenzoate.
What is the SMILES notation for prop-2-ynoyl 2-amino-4-methoxy-5-phenylmethoxybenzoate?
The canonical SMILES for prop-2-ynoyl 2-amino-4-methoxy-5-phenylmethoxybenzoate is C#CC(=O)OC(=O)c1cc(OCc2ccccc2)c(OC)cc1N.
What is the InChIKey of prop-2-ynoyl 2-amino-4-methoxy-5-phenylmethoxybenzoate?
The InChIKey is NMSVCLIREWAPLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO5/c1-3-17(20)24-18(21)13-9-16(15(22-2)10-14(13)19)23-11-12-7-5-4-6-8-12/h1,4-10H,11,19H2,2H3.
What are the key properties of prop-2-ynoyl 2-amino-4-methoxy-5-phenylmethoxybenzoate?
prop-2-ynoyl 2-amino-4-methoxy-5-phenylmethoxybenzoate has a molecular weight of 325.32 g/mol, XLogP of 2.17, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-ynoyl 2-amino-4-methoxy-5-phenylmethoxybenzoate is sourced from PubChem (CID 167352804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).