C35H27FN2O — CID 167356377
4-(4-tert-butyl-2-phenylphenyl)-2-dibenzofuran-4-yl-6-fluoro-1H-benzimidazole (PubChem CID 167356377) has the molecular formula C35H27FN2O and a molecular weight of 510.61 g/mol. Its IUPAC name is 4-(4-tert-butyl-2-phenylphenyl)-2-dibenzofuran-4-yl-6-fluoro-1H-benzimidazole.
| Compound Name | 4-(4-tert-butyl-2-phenylphenyl)-2-dibenzofuran-4-yl-6-fluoro-1H-benzimidazole |
|---|---|
| PubChem CID | 167356377 |
| Molecular Formula | C35H27FN2O |
| Molecular Weight | 510.61 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | 4-(4-tert-butyl-2-phenylphenyl)-2-dibenzofuran-4-yl-6-fluoro-1H-benzimidazole |
| SMILES | CC(C)(C)c1ccc(-c2cc(F)cc3[nH]c(-c4cccc5c4oc4ccccc45)nc23)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C35H27FN2O/c1-35(2,3)22-16-17-24(28(18-22)21-10-5-4-6-11-21)29-19-23(36)20-30-32(29)38-34(37-30)27-14-9-13-26-25-12-7-8-15-31(25)39-33(26)27/h4-20H,1-3H3,(H,37,38) |
| InChIKey | GXURGZYLFSCICB-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.61 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |