C23H36N2O5S — CID 167356782
methyl 4-[[(2S)-3-(hexylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]sulfanylmethyl]benzoate (PubChem CID 167356782) has the molecular formula C23H36N2O5S and a molecular weight of 452.62 g/mol. Its IUPAC name is methyl 4-[[(2S)-3-(hexylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]sulfanylmethyl]benzoate.
| Compound Name | methyl 4-[[(2S)-3-(hexylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 167356782 |
| Molecular Formula | C23H36N2O5S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | methyl 4-[[(2S)-3-(hexylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]sulfanylmethyl]benzoate |
| SMILES | CCCCCCNC(=O)[C@@H](CSCc1ccc(C(=O)OC)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H36N2O5S/c1-6-7-8-9-14-24-20(26)19(25-22(28)30-23(2,3)4)16-31-15-17-10-12-18(13-11-17)21(27)29-5/h10-13,19H,6-9,14-16H2,1-5H3,(H,24,26)(H,25,28)/t19-/m1/s1 |
| InChIKey | ZUDDEGSEJXWJNB-LJQANCHMSA-N |
| XLogP | 4.30 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|