C27H41N3O5 — CID 167356784
2-[(2S)-2-(decanoylamino)-3-(hexylamino)-3-oxopropyl]-1,3-benzoxazole-5-carboxylic acid (PubChem CID 167356784) has the molecular formula C27H41N3O5 and a molecular weight of 487.64 g/mol. Its IUPAC name is 2-[(2S)-2-(decanoylamino)-3-(hexylamino)-3-oxopropyl]-1,3-benzoxazole-5-carboxylic acid.
| Compound Name | 2-[(2S)-2-(decanoylamino)-3-(hexylamino)-3-oxopropyl]-1,3-benzoxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 167356784 |
| Molecular Formula | C27H41N3O5 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.30 |
| IUPAC Name | 2-[(2S)-2-(decanoylamino)-3-(hexylamino)-3-oxopropyl]-1,3-benzoxazole-5-carboxylic acid |
| SMILES | CCCCCCCCCC(=O)N[C@@H](Cc1nc2cc(C(=O)O)ccc2o1)C(=O)NCCCCCC |
| InChI | InChI=1S/C27H41N3O5/c1-3-5-7-9-10-11-12-14-24(31)29-22(26(32)28-17-13-8-6-4-2)19-25-30-21-18-20(27(33)34)15-16-23(21)35-25/h15-16,18,22H,3-14,17,19H2,1-2H3,(H,28,32)(H,29,31)(H,33,34)/t22-/m0/s1 |
| InChIKey | RBTSEQRSWLAVSL-QFIPXVFZSA-N |
| XLogP | 5.39 |
| TPSA | 121.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|