C28H42N4O5 — CID 167356825
3-[(2S)-2-(decanoylamino)-3-(hexylamino)-3-oxopropyl]-4-oxoquinazoline-6-carboxylic acid (PubChem CID 167356825) has the molecular formula C28H42N4O5 and a molecular weight of 514.67 g/mol. Its IUPAC name is 3-[(2S)-2-(decanoylamino)-3-(hexylamino)-3-oxopropyl]-4-oxoquinazoline-6-carboxylic acid.
| Compound Name | 3-[(2S)-2-(decanoylamino)-3-(hexylamino)-3-oxopropyl]-4-oxoquinazoline-6-carboxylic acid |
|---|---|
| PubChem CID | 167356825 |
| Molecular Formula | C28H42N4O5 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.32 |
| IUPAC Name | 3-[(2S)-2-(decanoylamino)-3-(hexylamino)-3-oxopropyl]-4-oxoquinazoline-6-carboxylic acid |
| SMILES | CCCCCCCCCC(=O)N[C@@H](Cn1cnc2ccc(C(=O)O)cc2c1=O)C(=O)NCCCCCC |
| InChI | InChI=1S/C28H42N4O5/c1-3-5-7-9-10-11-12-14-25(33)31-24(26(34)29-17-13-8-6-4-2)19-32-20-30-23-16-15-21(28(36)37)18-22(23)27(32)35/h15-16,18,20,24H,3-14,17,19H2,1-2H3,(H,29,34)(H,31,33)(H,36,37)/t24-/m0/s1 |
| InChIKey | DOCPPCBBFNIGCB-DEOSSOPVSA-N |
| XLogP | 4.42 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|