C21H31N3O2 — CID 43052254
N-nonyl-4-(4-oxoquinazolin-3-yl)butanamide (PubChem CID 43052254) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is N-nonyl-4-(4-oxoquinazolin-3-yl)butanamide.
| Compound Name | N-nonyl-4-(4-oxoquinazolin-3-yl)butanamide |
|---|---|
| PubChem CID | 43052254 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | N-nonyl-4-(4-oxoquinazolin-3-yl)butanamide |
| SMILES | CCCCCCCCCNC(=O)CCCn1cnc2ccccc2c1=O |
| InChI | InChI=1S/C21H31N3O2/c1-2-3-4-5-6-7-10-15-22-20(25)14-11-16-24-17-23-19-13-9-8-12-18(19)21(24)26/h8-9,12-13,17H,2-7,10-11,14-16H2,1H3,(H,22,25) |
| InChIKey | CZZKOHQSFFTDLO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|