C15H15N3O2 — CID 90537872
N-but-3-ynyl-3-(4-oxoquinazolin-3-yl)propanamide (PubChem CID 90537872) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is N-but-3-ynyl-3-(4-oxoquinazolin-3-yl)propanamide.
| Compound Name | N-but-3-ynyl-3-(4-oxoquinazolin-3-yl)propanamide |
|---|---|
| PubChem CID | 90537872 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-but-3-ynyl-3-(4-oxoquinazolin-3-yl)propanamide |
| SMILES | C#CCCNC(=O)CCn1cnc2ccccc2c1=O |
| InChI | InChI=1S/C15H15N3O2/c1-2-3-9-16-14(19)8-10-18-11-17-13-7-5-4-6-12(13)15(18)20/h1,4-7,11H,3,8-10H2,(H,16,19) |
| InChIKey | VIZABECQXQJXHX-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|