C16H31N5O2 — CID 167356814
N-[(2S)-3-azido-1-(hexylamino)-1-oxopropan-2-yl]heptanamide (PubChem CID 167356814) has the molecular formula C16H31N5O2 and a molecular weight of 325.46 g/mol. Its IUPAC name is N-[(2S)-3-azido-1-(hexylamino)-1-oxopropan-2-yl]heptanamide.
| Compound Name | N-[(2S)-3-azido-1-(hexylamino)-1-oxopropan-2-yl]heptanamide |
|---|---|
| PubChem CID | 167356814 |
| Molecular Formula | C16H31N5O2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.25 |
| IUPAC Name | N-[(2S)-3-azido-1-(hexylamino)-1-oxopropan-2-yl]heptanamide |
| SMILES | CCCCCCNC(=O)[C@H](CN=[N+]=[N-])NC(=O)CCCCCC |
| InChI | InChI=1S/C16H31N5O2/c1-3-5-7-9-11-15(22)20-14(13-19-21-17)16(23)18-12-10-8-6-4-2/h14H,3-13H2,1-2H3,(H,18,23)(H,20,22)/t14-/m0/s1 |
| InChIKey | PFMBTUSNOJRGSU-AWEZNQCLSA-N |
| XLogP | 3.45 |
| TPSA | 106.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|