C24H29F3NO3SSi — CID 167358992
CID 167358992 (PubChem CID 167358992) has the molecular formula C24H29F3NO3SSi and a molecular weight of 496.65 g/mol.
| Compound Name | CID 167358992 |
|---|---|
| PubChem CID | 167358992 |
| Molecular Formula | C24H29F3NO3SSi |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | — |
| SMILES | CC(C)c1cc(C(F)F)cc(C(C)C)c1CC(=O)N=[S@](=O)([Si])c1ccc(C(C)(C)O)cc1F |
| InChI | InChI=1S/C24H29F3NO3SSi/c1-13(2)17-9-15(23(26)27)10-18(14(3)4)19(17)12-22(29)28-32(31,33)21-8-7-16(11-20(21)25)24(5,6)30/h7-11,13-14,23,30H,12H2,1-6H3/t32-/m1/s1 |
| InChIKey | WNTIQONFKQTHFA-JGCGQSQUSA-N |
| XLogP | 5.92 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|