C27H32N6O — CID 167362366
4-isocyano-1-[4-(4-methylpiperazin-1-yl)cyclohexyl]-3-(4-phenoxyphenyl)pyrazol-5-amine (PubChem CID 167362366) has the molecular formula C27H32N6O and a molecular weight of 456.59 g/mol. Its IUPAC name is 4-isocyano-1-[4-(4-methylpiperazin-1-yl)cyclohexyl]-3-(4-phenoxyphenyl)pyrazol-5-amine.
| Compound Name | 4-isocyano-1-[4-(4-methylpiperazin-1-yl)cyclohexyl]-3-(4-phenoxyphenyl)pyrazol-5-amine |
|---|---|
| PubChem CID | 167362366 |
| Molecular Formula | C27H32N6O |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | 4-isocyano-1-[4-(4-methylpiperazin-1-yl)cyclohexyl]-3-(4-phenoxyphenyl)pyrazol-5-amine |
| SMILES | [C-]#[N+]c1c(-c2ccc(Oc3ccccc3)cc2)nn(C2CCC(N3CCN(C)CC3)CC2)c1N |
| InChI | InChI=1S/C27H32N6O/c1-29-26-25(20-8-14-24(15-9-20)34-23-6-4-3-5-7-23)30-33(27(26)28)22-12-10-21(11-13-22)32-18-16-31(2)17-19-32/h3-9,14-15,21-22H,10-13,16-19,28H2,2H3 |
| InChIKey | JJODMCPDHZJTBD-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 63.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|