C27H33N3O — CID 156724503
1-methyl-4-[4-[3-(4-phenoxyphenyl)pyrrol-1-yl]cyclohexyl]piperazine (PubChem CID 156724503) has the molecular formula C27H33N3O and a molecular weight of 415.58 g/mol. Its IUPAC name is 1-methyl-4-[4-[3-(4-phenoxyphenyl)pyrrol-1-yl]cyclohexyl]piperazine.
| Compound Name | 1-methyl-4-[4-[3-(4-phenoxyphenyl)pyrrol-1-yl]cyclohexyl]piperazine |
|---|---|
| PubChem CID | 156724503 |
| Molecular Formula | C27H33N3O |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.26 |
| IUPAC Name | 1-methyl-4-[4-[3-(4-phenoxyphenyl)pyrrol-1-yl]cyclohexyl]piperazine |
| SMILES | CN1CCN(C2CCC(n3ccc(-c4ccc(Oc5ccccc5)cc4)c3)CC2)CC1 |
| InChI | InChI=1S/C27H33N3O/c1-28-17-19-29(20-18-28)24-9-11-25(12-10-24)30-16-15-23(21-30)22-7-13-27(14-8-22)31-26-5-3-2-4-6-26/h2-8,13-16,21,24-25H,9-12,17-20H2,1H3 |
| InChIKey | KKYITLGKRLGGSE-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 20.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |