C26H32N4OS — CID 28957881
4-[1-[[1-methyl-3-(4-phenoxyphenyl)pyrazol-4-yl]methyl]piperidin-4-yl]thiomorpholine (PubChem CID 28957881) has the molecular formula C26H32N4OS and a molecular weight of 448.64 g/mol. Its IUPAC name is 4-[1-[[1-methyl-3-(4-phenoxyphenyl)pyrazol-4-yl]methyl]piperidin-4-yl]thiomorpholine.
| Compound Name | 4-[1-[[1-methyl-3-(4-phenoxyphenyl)pyrazol-4-yl]methyl]piperidin-4-yl]thiomorpholine |
|---|---|
| PubChem CID | 28957881 |
| Molecular Formula | C26H32N4OS |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 4-[1-[[1-methyl-3-(4-phenoxyphenyl)pyrazol-4-yl]methyl]piperidin-4-yl]thiomorpholine |
| SMILES | Cn1cc(CN2CCC(N3CCSCC3)CC2)c(-c2ccc(Oc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C26H32N4OS/c1-28-19-22(20-29-13-11-23(12-14-29)30-15-17-32-18-16-30)26(27-28)21-7-9-25(10-8-21)31-24-5-3-2-4-6-24/h2-10,19,23H,11-18,20H2,1H3 |
| InChIKey | HONHHFSPIZAFLJ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |