C23H30ClN3O — CID 167845906
1-[1-[(2-chloro-4-phenoxyphenyl)methyl]piperidin-4-yl]-4-methylpiperazine (PubChem CID 167845906) has the molecular formula C23H30ClN3O and a molecular weight of 399.97 g/mol. Its IUPAC name is 1-[1-[(2-chloro-4-phenoxyphenyl)methyl]piperidin-4-yl]-4-methylpiperazine.
| Compound Name | 1-[1-[(2-chloro-4-phenoxyphenyl)methyl]piperidin-4-yl]-4-methylpiperazine |
|---|---|
| PubChem CID | 167845906 |
| Molecular Formula | C23H30ClN3O |
| Molecular Weight | 399.97 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 1-[1-[(2-chloro-4-phenoxyphenyl)methyl]piperidin-4-yl]-4-methylpiperazine |
| SMILES | CN1CCN(C2CCN(Cc3ccc(Oc4ccccc4)cc3Cl)CC2)CC1 |
| InChI | InChI=1S/C23H30ClN3O/c1-25-13-15-27(16-14-25)20-9-11-26(12-10-20)18-19-7-8-22(17-23(19)24)28-21-5-3-2-4-6-21/h2-8,17,20H,9-16,18H2,1H3 |
| InChIKey | RXJPNVRIBMCGAB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.97 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |