C37H33N2OS+ — CID 167365005
2-[4-[3,7-dimethyl-2-(3-methyl-8-phenyldibenzothiophen-4-yl)benzimidazol-3-ium-1-yl]phenyl]propan-2-ol (PubChem CID 167365005) has the molecular formula C37H33N2OS+ and a molecular weight of 553.75 g/mol. Its IUPAC name is 2-[4-[3,7-dimethyl-2-(3-methyl-8-phenyldibenzothiophen-4-yl)benzimidazol-3-ium-1-yl]phenyl]propan-2-ol.
| Compound Name | 2-[4-[3,7-dimethyl-2-(3-methyl-8-phenyldibenzothiophen-4-yl)benzimidazol-3-ium-1-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 167365005 |
| Molecular Formula | C37H33N2OS+ |
| Molecular Weight | 553.75 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | 2-[4-[3,7-dimethyl-2-(3-methyl-8-phenyldibenzothiophen-4-yl)benzimidazol-3-ium-1-yl]phenyl]propan-2-ol |
| SMILES | Cc1ccc2c(sc3ccc(-c4ccccc4)cc32)c1-c1n(-c2ccc(C(C)(C)O)cc2)c2c(C)cccc2[n+]1C |
| InChI | InChI=1S/C37H33N2OS/c1-23-14-20-29-30-22-26(25-11-7-6-8-12-25)15-21-32(30)41-35(29)33(23)36-38(5)31-13-9-10-24(2)34(31)39(36)28-18-16-27(17-19-28)37(3,4)40/h6-22,40H,1-5H3/q+1 |
| InChIKey | ODGKSTGNFXSBSI-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 29.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.75 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|