C24H23N5O2 — CID 167366973
[(3R)-piperidin-3-yl] 6-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]quinoline-3-carboxylate (PubChem CID 167366973) has the molecular formula C24H23N5O2 and a molecular weight of 413.48 g/mol. Its IUPAC name is [(3R)-piperidin-3-yl] 6-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]quinoline-3-carboxylate.
| Compound Name | [(3R)-piperidin-3-yl] 6-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 167366973 |
| Molecular Formula | C24H23N5O2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | [(3R)-piperidin-3-yl] 6-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]quinoline-3-carboxylate |
| SMILES | Cc1cccc(-c2[nH]ncc2-c2ccc3ncc(C(=O)O[C@@H]4CCCNC4)cc3c2)n1 |
| InChI | InChI=1S/C24H23N5O2/c1-15-4-2-6-22(28-15)23-20(14-27-29-23)16-7-8-21-17(10-16)11-18(12-26-21)24(30)31-19-5-3-9-25-13-19/h2,4,6-8,10-12,14,19,25H,3,5,9,13H2,1H3,(H,27,29)/t19-/m1/s1 |
| InChIKey | UBKAVIIOJDSSCO-LJQANCHMSA-N |
| XLogP | 3.90 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |