C26H27N5O2 — CID 167367180
3-pyrrolidin-1-ylpropyl 6-[5-(6-methyl-2-pyridinyl)-1H-imidazol-4-yl]quinoline-4-carboxylate (PubChem CID 167367180) has the molecular formula C26H27N5O2 and a molecular weight of 441.54 g/mol. Its IUPAC name is 3-pyrrolidin-1-ylpropyl 6-[5-(6-methyl-2-pyridinyl)-1H-imidazol-4-yl]quinoline-4-carboxylate.
| Compound Name | 3-pyrrolidin-1-ylpropyl 6-[5-(6-methyl-2-pyridinyl)-1H-imidazol-4-yl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 167367180 |
| Molecular Formula | C26H27N5O2 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 3-pyrrolidin-1-ylpropyl 6-[5-(6-methyl-2-pyridinyl)-1H-imidazol-4-yl]quinoline-4-carboxylate |
| SMILES | Cc1cccc(-c2[nH]cnc2-c2ccc3nccc(C(=O)OCCCN4CCCC4)c3c2)n1 |
| InChI | InChI=1S/C26H27N5O2/c1-18-6-4-7-23(30-18)25-24(28-17-29-25)19-8-9-22-21(16-19)20(10-11-27-22)26(32)33-15-5-14-31-12-2-3-13-31/h4,6-11,16-17H,2-3,5,12-15H2,1H3,(H,28,29) |
| InChIKey | QGVXODXIFBBAIA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|