C16H21N3O2 — CID 15544726
3-piperidin-1-ylpropyl 1H-benzimidazole-4-carboxylate (PubChem CID 15544726) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 3-piperidin-1-ylpropyl 1H-benzimidazole-4-carboxylate.
| Compound Name | 3-piperidin-1-ylpropyl 1H-benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 15544726 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 3-piperidin-1-ylpropyl 1H-benzimidazole-4-carboxylate |
| SMILES | O=C(OCCCN1CCCCC1)c1cccc2[nH]cnc12 |
| InChI | InChI=1S/C16H21N3O2/c20-16(13-6-4-7-14-15(13)18-12-17-14)21-11-5-10-19-8-2-1-3-9-19/h4,6-7,12H,1-3,5,8-11H2,(H,17,18) |
| InChIKey | BHXYCCRLJIESLT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|