C15H17N3O2 — CID 850956
[(3S)-1-azabicyclo[2.2.2]octan-3-yl] 1H-benzimidazole-4-carboxylate (PubChem CID 850956) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is [(3S)-1-azabicyclo[2.2.2]octan-3-yl] 1H-benzimidazole-4-carboxylate.
| Compound Name | [(3S)-1-azabicyclo[2.2.2]octan-3-yl] 1H-benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 850956 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | [(3S)-1-azabicyclo[2.2.2]octan-3-yl] 1H-benzimidazole-4-carboxylate |
| SMILES | O=C(O[C@@H]1CN2CCC1CC2)c1cccc2[nH]cnc12 |
| InChI | InChI=1S/C15H17N3O2/c19-15(11-2-1-3-12-14(11)17-9-16-12)20-13-8-18-6-4-10(13)5-7-18/h1-3,9-10,13H,4-8H2,(H,16,17)/t13-/m1/s1 |
| InChIKey | GWWYTCNQOVHBHJ-CYBMUJFWSA-N |
| XLogP | 1.81 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |