C17H20N2O5 — CID 69396926
1-cyclohexyloxycarbonyloxyethyl 1H-benzimidazole-4-carboxylate (PubChem CID 69396926) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is 1-cyclohexyloxycarbonyloxyethyl 1H-benzimidazole-4-carboxylate.
| Compound Name | 1-cyclohexyloxycarbonyloxyethyl 1H-benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 69396926 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 1-cyclohexyloxycarbonyloxyethyl 1H-benzimidazole-4-carboxylate |
| SMILES | CC(OC(=O)OC1CCCCC1)OC(=O)c1cccc2[nH]cnc12 |
| InChI | InChI=1S/C17H20N2O5/c1-11(23-17(21)24-12-6-3-2-4-7-12)22-16(20)13-8-5-9-14-15(13)19-10-18-14/h5,8-12H,2-4,6-7H2,1H3,(H,18,19) |
| InChIKey | LZTHTXNGIPWZEW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 90.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|