C14H19NO5 — CID 141101491
1-cyclohexyloxycarbonyloxyethyl 1H-pyrrole-2-carboxylate (PubChem CID 141101491) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is 1-cyclohexyloxycarbonyloxyethyl 1H-pyrrole-2-carboxylate.
| Compound Name | 1-cyclohexyloxycarbonyloxyethyl 1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 141101491 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 1-cyclohexyloxycarbonyloxyethyl 1H-pyrrole-2-carboxylate |
| SMILES | CC(OC(=O)OC1CCCCC1)OC(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C14H19NO5/c1-10(18-13(16)12-8-5-9-15-12)19-14(17)20-11-6-3-2-4-7-11/h5,8-11,15H,2-4,6-7H2,1H3 |
| InChIKey | AOSIHLSWLIPPMX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 77.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|