C19H33NO7 — CID 88979422
1-cyclohexyloxycarbonyloxyethyl (3S)-3-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 88979422) has the molecular formula C19H33NO7 and a molecular weight of 387.47 g/mol. Its IUPAC name is 1-cyclohexyloxycarbonyloxyethyl (3S)-3-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | 1-cyclohexyloxycarbonyloxyethyl (3S)-3-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 88979422 |
| Molecular Formula | C19H33NO7 |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 1-cyclohexyloxycarbonyloxyethyl (3S)-3-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC(OC(=O)C[C@H](C)CNC(=O)OC(C)(C)C)OC(=O)OC1CCCCC1 |
| InChI | InChI=1S/C19H33NO7/c1-13(12-20-17(22)27-19(3,4)5)11-16(21)24-14(2)25-18(23)26-15-9-7-6-8-10-15/h13-15H,6-12H2,1-5H3,(H,20,22)/t13-,14?/m0/s1 |
| InChIKey | MQOUKELTLSEMIY-LSLKUGRBSA-N |
| XLogP | 3.91 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|