C23H24ClNO4 — CID 16736755
1-[[4-(5-butoxy-1-benzofuran-2-yl)-3-chlorophenyl]methyl]azetidine-3-carboxylic acid (PubChem CID 16736755) has the molecular formula C23H24ClNO4 and a molecular weight of 413.90 g/mol. Its IUPAC name is 1-[[4-(5-butoxy-1-benzofuran-2-yl)-3-chlorophenyl]methyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[[4-(5-butoxy-1-benzofuran-2-yl)-3-chlorophenyl]methyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 16736755 |
| Molecular Formula | C23H24ClNO4 |
| Molecular Weight | 413.90 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 1-[[4-(5-butoxy-1-benzofuran-2-yl)-3-chlorophenyl]methyl]azetidine-3-carboxylic acid |
| SMILES | CCCCOc1ccc2oc(-c3ccc(CN4CC(C(=O)O)C4)cc3Cl)cc2c1 |
| InChI | InChI=1S/C23H24ClNO4/c1-2-3-8-28-18-5-7-21-16(10-18)11-22(29-21)19-6-4-15(9-20(19)24)12-25-13-17(14-25)23(26)27/h4-7,9-11,17H,2-3,8,12-14H2,1H3,(H,26,27) |
| InChIKey | KAEUWGJEROCSNU-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.90 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|