C24H27NO5 — CID 16737316
1-[[4-(5-butoxy-1-benzofuran-2-yl)-3-methoxyphenyl]methyl]azetidine-3-carboxylic acid (PubChem CID 16737316) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is 1-[[4-(5-butoxy-1-benzofuran-2-yl)-3-methoxyphenyl]methyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[[4-(5-butoxy-1-benzofuran-2-yl)-3-methoxyphenyl]methyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 16737316 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 1-[[4-(5-butoxy-1-benzofuran-2-yl)-3-methoxyphenyl]methyl]azetidine-3-carboxylic acid |
| SMILES | CCCCOc1ccc2oc(-c3ccc(CN4CC(C(=O)O)C4)cc3OC)cc2c1 |
| InChI | InChI=1S/C24H27NO5/c1-3-4-9-29-19-6-8-21-17(11-19)12-23(30-21)20-7-5-16(10-22(20)28-2)13-25-14-18(15-25)24(26)27/h5-8,10-12,18H,3-4,9,13-15H2,1-2H3,(H,26,27) |
| InChIKey | BFJBNYIYUUPKMY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 72.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|