C21H21FN6OS — CID 167368858
2-[5-[1-[(1R,3R,4R,5R)-4-fluoro-1-methyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]ethenyl]-1,3,4-thiadiazol-2-yl]-5-(4-methyltriazol-2-yl)phenol (PubChem CID 167368858) has the molecular formula C21H21FN6OS and a molecular weight of 424.51 g/mol. Its IUPAC name is 2-[5-[1-[(1R,3R,4R,5R)-4-fluoro-1-methyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]ethenyl]-1,3,4-thiadiazol-2-yl]-5-(4-methyltriazol-2-yl)phenol.
| Compound Name | 2-[5-[1-[(1R,3R,4R,5R)-4-fluoro-1-methyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]ethenyl]-1,3,4-thiadiazol-2-yl]-5-(4-methyltriazol-2-yl)phenol |
|---|---|
| PubChem CID | 167368858 |
| Molecular Formula | C21H21FN6OS |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 2-[5-[1-[(1R,3R,4R,5R)-4-fluoro-1-methyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]ethenyl]-1,3,4-thiadiazol-2-yl]-5-(4-methyltriazol-2-yl)phenol |
| SMILES | C=C(c1nnc(-c2ccc(-n3ncc(C)n3)cc2O)s1)[C@H]1C[C@]2(C)C=C[C@@H](N2)[C@@H]1F |
| InChI | InChI=1S/C21H21FN6OS/c1-11-10-23-28(27-11)13-4-5-14(17(29)8-13)20-26-25-19(30-20)12(2)15-9-21(3)7-6-16(24-21)18(15)22/h4-8,10,15-16,18,24,29H,2,9H2,1,3H3/t15-,16-,18-,21+/m1/s1 |
| InChIKey | JGHFFARVOXOLMZ-PZPFTHLGSA-N |
| XLogP | 3.46 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|