C22H23FN6OS — CID 167368909
2-[5-[1-[(1R,2R,3R,5R)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]ethenyl]-1,3,4-thiadiazol-2-yl]-5-(4-methyltriazol-2-yl)phenol (PubChem CID 167368909) has the molecular formula C22H23FN6OS and a molecular weight of 438.53 g/mol. Its IUPAC name is 2-[5-[1-[(1R,2R,3R,5R)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]ethenyl]-1,3,4-thiadiazol-2-yl]-5-(4-methyltriazol-2-yl)phenol.
| Compound Name | 2-[5-[1-[(1R,2R,3R,5R)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]ethenyl]-1,3,4-thiadiazol-2-yl]-5-(4-methyltriazol-2-yl)phenol |
|---|---|
| PubChem CID | 167368909 |
| Molecular Formula | C22H23FN6OS |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 2-[5-[1-[(1R,2R,3R,5R)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]ethenyl]-1,3,4-thiadiazol-2-yl]-5-(4-methyltriazol-2-yl)phenol |
| SMILES | C=C(c1nnc(-c2ccc(-n3ncc(C)n3)cc2O)s1)[C@H]1C[C@]2(C)C=C[C@@](C)(N2)[C@@H]1F |
| InChI | InChI=1S/C22H23FN6OS/c1-12-11-24-29(27-12)14-5-6-15(17(30)9-14)20-26-25-19(31-20)13(2)16-10-21(3)7-8-22(4,28-21)18(16)23/h5-9,11,16,18,28,30H,2,10H2,1,3-4H3/t16-,18-,21+,22-/m1/s1 |
| InChIKey | MZEQOOAGRSSTMN-OJAWGZOXSA-N |
| XLogP | 3.85 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|