C20H19FN6OS — CID 167369142
2-[5-[1-[(1R,2R,3R,5R)-2-fluoro-8-azabicyclo[3.2.1]oct-6-en-3-yl]ethenyl]-1,3,4-thiadiazol-2-yl]-5-(4-methyltriazol-2-yl)phenol (PubChem CID 167369142) has the molecular formula C20H19FN6OS and a molecular weight of 410.48 g/mol. Its IUPAC name is 2-[5-[1-[(1R,2R,3R,5R)-2-fluoro-8-azabicyclo[3.2.1]oct-6-en-3-yl]ethenyl]-1,3,4-thiadiazol-2-yl]-5-(4-methyltriazol-2-yl)phenol.
| Compound Name | 2-[5-[1-[(1R,2R,3R,5R)-2-fluoro-8-azabicyclo[3.2.1]oct-6-en-3-yl]ethenyl]-1,3,4-thiadiazol-2-yl]-5-(4-methyltriazol-2-yl)phenol |
|---|---|
| PubChem CID | 167369142 |
| Molecular Formula | C20H19FN6OS |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 2-[5-[1-[(1R,2R,3R,5R)-2-fluoro-8-azabicyclo[3.2.1]oct-6-en-3-yl]ethenyl]-1,3,4-thiadiazol-2-yl]-5-(4-methyltriazol-2-yl)phenol |
| SMILES | C=C(c1nnc(-c2ccc(-n3ncc(C)n3)cc2O)s1)[C@H]1C[C@@H]2C=C[C@@H](N2)[C@@H]1F |
| InChI | InChI=1S/C20H19FN6OS/c1-10-9-22-27(26-10)13-4-5-14(17(28)8-13)20-25-24-19(29-20)11(2)15-7-12-3-6-16(23-12)18(15)21/h3-6,8-9,12,15-16,18,23,28H,2,7H2,1H3/t12-,15+,16+,18+/m0/s1 |
| InChIKey | XJUSAQDPRNNINC-LMWIJYBJSA-N |
| XLogP | 3.07 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|