C20H22FN5O2S — CID 167368908
2-[5-[[(1R,2R,3S,5S)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-1,3,4-thiadiazol-2-yl]-5-imidazol-1-ylphenol (PubChem CID 167368908) has the molecular formula C20H22FN5O2S and a molecular weight of 415.49 g/mol. Its IUPAC name is 2-[5-[[(1R,2R,3S,5S)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-1,3,4-thiadiazol-2-yl]-5-imidazol-1-ylphenol.
| Compound Name | 2-[5-[[(1R,2R,3S,5S)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-1,3,4-thiadiazol-2-yl]-5-imidazol-1-ylphenol |
|---|---|
| PubChem CID | 167368908 |
| Molecular Formula | C20H22FN5O2S |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 2-[5-[[(1R,2R,3S,5S)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-1,3,4-thiadiazol-2-yl]-5-imidazol-1-ylphenol |
| SMILES | C[C@@]12CC[C@@](C)(N1)[C@@H](F)[C@@H](Oc1nnc(-c3ccc(-n4ccnc4)cc3O)s1)C2 |
| InChI | InChI=1S/C20H22FN5O2S/c1-19-5-6-20(2,25-19)16(21)15(10-19)28-18-24-23-17(29-18)13-4-3-12(9-14(13)27)26-8-7-22-11-26/h3-4,7-9,11,15-16,25,27H,5-6,10H2,1-2H3/t15-,16-,19-,20+/m0/s1 |
| InChIKey | VWNILWRUGVOHRB-CPLUKWAASA-N |
| XLogP | 3.49 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |