C22H25BFN5O4 — CID 167369782
[(5S,6S)-6-fluoro-5-[6-[4-imidazol-1-yl-2-(methoxymethoxy)phenyl]pyridazin-3-yl]oxy-2-azabicyclo[2.2.1]heptan-2-yl]-methylborinic acid (PubChem CID 167369782) has the molecular formula C22H25BFN5O4 and a molecular weight of 453.28 g/mol. Its IUPAC name is [(5S,6S)-6-fluoro-5-[6-[4-imidazol-1-yl-2-(methoxymethoxy)phenyl]pyridazin-3-yl]oxy-2-azabicyclo[2.2.1]heptan-2-yl]-methylborinic acid.
| Compound Name | [(5S,6S)-6-fluoro-5-[6-[4-imidazol-1-yl-2-(methoxymethoxy)phenyl]pyridazin-3-yl]oxy-2-azabicyclo[2.2.1]heptan-2-yl]-methylborinic acid |
|---|---|
| PubChem CID | 167369782 |
| Molecular Formula | C22H25BFN5O4 |
| Molecular Weight | 453.28 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | [(5S,6S)-6-fluoro-5-[6-[4-imidazol-1-yl-2-(methoxymethoxy)phenyl]pyridazin-3-yl]oxy-2-azabicyclo[2.2.1]heptan-2-yl]-methylborinic acid |
| SMILES | COCOc1cc(-n2ccnc2)ccc1-c1ccc(O[C@H]2C3CC([C@@H]2F)N(B(C)O)C3)nn1 |
| InChI | InChI=1S/C22H25BFN5O4/c1-23(30)29-11-14-9-18(29)21(24)22(14)33-20-6-5-17(26-27-20)16-4-3-15(28-8-7-25-12-28)10-19(16)32-13-31-2/h3-8,10,12,14,18,21-22,30H,9,11,13H2,1-2H3/t14?,18?,21-,22-/m0/s1 |
| InChIKey | MTLGNAHDQZPUFL-WCPKVPPHSA-N |
| XLogP | 2.21 |
| TPSA | 94.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|