C24H29BFN5O4 — CID 167360740
[(2R,3S)-2-fluoro-3-[6-[4-imidazol-1-yl-2-(methoxymethoxy)phenyl]pyridazin-3-yl]oxy-9-azabicyclo[3.3.1]nonan-9-yl]-methylborinic acid (PubChem CID 167360740) has the molecular formula C24H29BFN5O4 and a molecular weight of 481.34 g/mol. Its IUPAC name is [(2R,3S)-2-fluoro-3-[6-[4-imidazol-1-yl-2-(methoxymethoxy)phenyl]pyridazin-3-yl]oxy-9-azabicyclo[3.3.1]nonan-9-yl]-methylborinic acid.
| Compound Name | [(2R,3S)-2-fluoro-3-[6-[4-imidazol-1-yl-2-(methoxymethoxy)phenyl]pyridazin-3-yl]oxy-9-azabicyclo[3.3.1]nonan-9-yl]-methylborinic acid |
|---|---|
| PubChem CID | 167360740 |
| Molecular Formula | C24H29BFN5O4 |
| Molecular Weight | 481.34 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | [(2R,3S)-2-fluoro-3-[6-[4-imidazol-1-yl-2-(methoxymethoxy)phenyl]pyridazin-3-yl]oxy-9-azabicyclo[3.3.1]nonan-9-yl]-methylborinic acid |
| SMILES | COCOc1cc(-n2ccnc2)ccc1-c1ccc(O[C@H]2CC3CCCC([C@H]2F)N3B(C)O)nn1 |
| InChI | InChI=1S/C24H29BFN5O4/c1-25(32)31-17-4-3-5-20(31)24(26)22(13-17)35-23-9-8-19(28-29-23)18-7-6-16(30-11-10-27-14-30)12-21(18)34-15-33-2/h6-12,14,17,20,22,24,32H,3-5,13,15H2,1-2H3/t17?,20?,22-,24+/m0/s1 |
| InChIKey | WWCMCXVHMBDKBO-JABQCBPASA-N |
| XLogP | 3.13 |
| TPSA | 94.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|