C20H14ClF3N4O4 — CID 167370737
4-[[2-[(6-chloro-2-methoxy-3-pyridinyl)oxy]-6-(trifluoromethyl)benzoyl]amino]pyridine-2-carboxamide (PubChem CID 167370737) has the molecular formula C20H14ClF3N4O4 and a molecular weight of 466.80 g/mol. Its IUPAC name is 4-[[2-[(6-chloro-2-methoxy-3-pyridinyl)oxy]-6-(trifluoromethyl)benzoyl]amino]pyridine-2-carboxamide.
| Compound Name | 4-[[2-[(6-chloro-2-methoxy-3-pyridinyl)oxy]-6-(trifluoromethyl)benzoyl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 167370737 |
| Molecular Formula | C20H14ClF3N4O4 |
| Molecular Weight | 466.80 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | 4-[[2-[(6-chloro-2-methoxy-3-pyridinyl)oxy]-6-(trifluoromethyl)benzoyl]amino]pyridine-2-carboxamide |
| SMILES | COc1nc(Cl)ccc1Oc1cccc(C(F)(F)F)c1C(=O)Nc1ccnc(C(N)=O)c1 |
| InChI | InChI=1S/C20H14ClF3N4O4/c1-31-19-14(5-6-15(21)28-19)32-13-4-2-3-11(20(22,23)24)16(13)18(30)27-10-7-8-26-12(9-10)17(25)29/h2-9H,1H3,(H2,25,29)(H,26,27,30) |
| InChIKey | HWJNIMAQYJYYCV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 116.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.80 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|