C21H16ClF2N3O4 — CID 160689602
N-(4-carbamoyl-3-fluorophenyl)-6-[(6-chloro-2-methoxy-3-pyridinyl)oxy]-2-fluoro-3-methylbenzamide (PubChem CID 160689602) has the molecular formula C21H16ClF2N3O4 and a molecular weight of 447.83 g/mol. Its IUPAC name is N-(4-carbamoyl-3-fluorophenyl)-6-[(6-chloro-2-methoxy-3-pyridinyl)oxy]-2-fluoro-3-methylbenzamide.
| Compound Name | N-(4-carbamoyl-3-fluorophenyl)-6-[(6-chloro-2-methoxy-3-pyridinyl)oxy]-2-fluoro-3-methylbenzamide |
|---|---|
| PubChem CID | 160689602 |
| Molecular Formula | C21H16ClF2N3O4 |
| Molecular Weight | 447.83 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | N-(4-carbamoyl-3-fluorophenyl)-6-[(6-chloro-2-methoxy-3-pyridinyl)oxy]-2-fluoro-3-methylbenzamide |
| SMILES | COc1nc(Cl)ccc1Oc1ccc(C)c(F)c1C(=O)Nc1ccc(C(N)=O)c(F)c1 |
| InChI | InChI=1S/C21H16ClF2N3O4/c1-10-3-6-14(31-15-7-8-16(22)27-21(15)30-2)17(18(10)24)20(29)26-11-4-5-12(19(25)28)13(23)9-11/h3-9H,1-2H3,(H2,25,28)(H,26,29) |
| InChIKey | JOBDZJMXSDMTQB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.83 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|