C20H15F3N4O4 — CID 137418848
N-(3-carbamoyl-4-fluorophenyl)-2-fluoro-3-(fluoroamino)-6-[(6-methoxy-3-pyridinyl)oxy]benzamide (PubChem CID 137418848) has the molecular formula C20H15F3N4O4 and a molecular weight of 432.36 g/mol. Its IUPAC name is N-(3-carbamoyl-4-fluorophenyl)-2-fluoro-3-(fluoroamino)-6-[(6-methoxy-3-pyridinyl)oxy]benzamide.
| Compound Name | N-(3-carbamoyl-4-fluorophenyl)-2-fluoro-3-(fluoroamino)-6-[(6-methoxy-3-pyridinyl)oxy]benzamide |
|---|---|
| PubChem CID | 137418848 |
| Molecular Formula | C20H15F3N4O4 |
| Molecular Weight | 432.36 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | N-(3-carbamoyl-4-fluorophenyl)-2-fluoro-3-(fluoroamino)-6-[(6-methoxy-3-pyridinyl)oxy]benzamide |
| SMILES | COc1ccc(Oc2ccc(NF)c(F)c2C(=O)Nc2ccc(F)c(C(N)=O)c2)cn1 |
| InChI | InChI=1S/C20H15F3N4O4/c1-30-16-7-3-11(9-25-16)31-15-6-5-14(27-23)18(22)17(15)20(29)26-10-2-4-13(21)12(8-10)19(24)28/h2-9,27H,1H3,(H2,24,28)(H,26,29) |
| InChIKey | XCLIADGRTVOZCW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|